C29H59NO5 — CID 175093348
2-(dodecanoylamino)pentanedioic acid;bis(hexane) (PubChem CID 175093348) has the molecular formula C29H59NO5 and a molecular weight of 501.79 g/mol. Its IUPAC name is 2-(dodecanoylamino)pentanedioic acid;bis(hexane).
| Compound Name | 2-(dodecanoylamino)pentanedioic acid;bis(hexane) |
|---|---|
| PubChem CID | 175093348 |
| Molecular Formula | C29H59NO5 |
| Molecular Weight | 501.79 g/mol |
| Exact Mass | 501.44 |
| IUPAC Name | 2-(dodecanoylamino)pentanedioic acid;bis(hexane) |
| SMILES | CCCCCC.CCCCCC.CCCCCCCCCCCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H31NO5.2C6H14/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;2*1-3-5-6-4-2/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);2*3-6H2,1-2H3 |
| InChIKey | YZXCJCYREBGUOS-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.79 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|