C11H19NO5 — CID 54368145
(2S)-2-(hexanoylamino)pentanedioic acid (PubChem CID 54368145) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (2S)-2-(hexanoylamino)pentanedioic acid.
| Compound Name | (2S)-2-(hexanoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 54368145 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (2S)-2-(hexanoylamino)pentanedioic acid |
| SMILES | CCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19NO5/c1-2-3-4-5-9(13)12-8(11(16)17)6-7-10(14)15/h8H,2-7H2,1H3,(H,12,13)(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | URFOBMAEWASLQK-QMMMGPOBSA-N |
| XLogP | 1.00 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|