N-Myristoyl-L-glutamic acid sodium salt

C19H35NNaO5 — CID 87532244

IUPAC—
SMILESCCCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O.[Na]
InChIInChI=1S/C19H35NO5.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16(19(24)25)14-15-18(22)23;/h16H,2-15H2,1H3,(H,20,21)(H,22,23)(H,24,25);/t16-;/m0./s1
InChIKeyFCBUGCHAVCFTHW-NTISSMGPSA-N
MW380.48 g/mol
LogP3.74
Rot. Bonds17

About N-Myristoyl-L-glutamic acid sodium salt

N-Myristoyl-L-glutamic acid sodium salt (PubChem CID 87532244) has the molecular formula C19H35NNaO5 and a molecular weight of 380.48 g/mol.

Molecular Properties

Compound NameN-Myristoyl-L-glutamic acid sodium salt
PubChem CID87532244
Molecular FormulaC19H35NNaO5
Molecular Weight380.48 g/mol
Exact Mass380.24
IUPAC Name—
SMILESCCCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O.[Na]
InChIInChI=1S/C19H35NO5.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16(19(24)25)14-15-18(22)23;/h16H,2-15H2,1H3,(H,20,21)(H,22,23)(H,24,25);/t16-;/m0./s1
InChIKeyFCBUGCHAVCFTHW-NTISSMGPSA-N
XLogP3.74
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds17
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500380.48
LogP ≤ 53.74
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze N-Myristoyl-L-glutamic acid sodium salt with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-(tetradecanoylamino)pentanedioic acid
CID 18634845
2-(dodecanoylamino)pentanedioic acid;bis(hexane)
CID 175093348
(2R)-2-(undecanoylamino)pentanedioic acid
CID 11472521
potassium (2R)-2-(dodecanoylamino)pentanedioic acid
CID 10270407
alumane;(2S)-2-(dodecanoylamino)pentanedioic acid
CID 173075186
azane;(2S)-2-(dodecanoylamino)pentanedioic acid
CID 173170599
(2S)-2-(hexanoylamino)pentanedioic acid
CID 54368145
sodium;(2R)-2-(hexadecanoylamino)pentanedioic acid;hydride
CID 173283992
2-(dodecanoylamino)pentanedioic acid;bis(hexanamide)
CID 175413316
hexadecan-7-ol;(2S)-2-(hexadecanoylamino)pentanedioic acid
CID 175883903
(2S)-2-[[10-[[(1S)-1,3-dicarboxypropyl]amino]-10-oxodecanoyl]amino]pentanedioic acid
CID 92974928
bis(2-methylpropanamide);(2S)-2-(octanoylamino)pentanedioic acid
CID 157237897

Frequently Asked Questions

What is the IUPAC name of N-Myristoyl-L-glutamic acid sodium salt?
The IUPAC name of N-Myristoyl-L-glutamic acid sodium salt (CID 87532244) is not available.
What is the SMILES notation for N-Myristoyl-L-glutamic acid sodium salt?
The canonical SMILES for N-Myristoyl-L-glutamic acid sodium salt is CCCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O.[Na].
What is the InChIKey of N-Myristoyl-L-glutamic acid sodium salt?
The InChIKey is FCBUGCHAVCFTHW-NTISSMGPSA-N. The full InChI is InChI=1S/C19H35NO5.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16(19(24)25)14-15-18(22)23;/h16H,2-15H2,1H3,(H,20,21)(H,22,23)(H,24,25);/t16-;/m0./s1.
What are the key properties of N-Myristoyl-L-glutamic acid sodium salt?
N-Myristoyl-L-glutamic acid sodium salt has a molecular weight of 380.48 g/mol, XLogP of 3.74, 17 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-Myristoyl-L-glutamic acid sodium salt is sourced from PubChem (CID 87532244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).