C20H32N2O10 — CID 92974928
(2S)-2-[[10-[[(1S)-1,3-dicarboxypropyl]amino]-10-oxodecanoyl]amino]pentanedioic acid (PubChem CID 92974928) has the molecular formula C20H32N2O10 and a molecular weight of 460.48 g/mol. Its IUPAC name is (2S)-2-[[10-[[(1S)-1,3-dicarboxypropyl]amino]-10-oxodecanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[10-[[(1S)-1,3-dicarboxypropyl]amino]-10-oxodecanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 92974928 |
| Molecular Formula | C20H32N2O10 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (2S)-2-[[10-[[(1S)-1,3-dicarboxypropyl]amino]-10-oxodecanoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)CCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N2O10/c23-15(21-13(19(29)30)9-11-17(25)26)7-5-3-1-2-4-6-8-16(24)22-14(20(31)32)10-12-18(27)28/h13-14H,1-12H2,(H,21,23)(H,22,24)(H,25,26)(H,27,28)(H,29,30)(H,31,32)/t13-,14-/m0/s1 |
| InChIKey | NRRYINZATARDIG-KBPBESRZSA-N |
| XLogP | 0.98 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|