C16H24N2O10 — CID 100780583
(2S)-2-[[6-[[(1S)-1,3-dicarboxypropyl]amino]-6-oxohexanoyl]amino]pentanedioic acid (PubChem CID 100780583) has the molecular formula C16H24N2O10 and a molecular weight of 404.37 g/mol. Its IUPAC name is (2S)-2-[[6-[[(1S)-1,3-dicarboxypropyl]amino]-6-oxohexanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[6-[[(1S)-1,3-dicarboxypropyl]amino]-6-oxohexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 100780583 |
| Molecular Formula | C16H24N2O10 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S)-2-[[6-[[(1S)-1,3-dicarboxypropyl]amino]-6-oxohexanoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)CCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24N2O10/c19-11(17-9(15(25)26)5-7-13(21)22)3-1-2-4-12(20)18-10(16(27)28)6-8-14(23)24/h9-10H,1-8H2,(H,17,19)(H,18,20)(H,21,22)(H,23,24)(H,25,26)(H,27,28)/t9-,10-/m0/s1 |
| InChIKey | DXOIYFIIFVGAOB-UWVGGRQHSA-N |
| XLogP | -0.58 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|