azane;(2S)-2-(dodecanoylamino)pentanedioic acid

C17H37N3O5 — CID 173170599

IUPACazane;(2S)-2-(dodecanoylamino)pentanedioic acid
SMILESCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O.N.N
InChIInChI=1S/C17H31NO5.2H3N/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);2*1H3/t14-;;/m0../s1
InChIKeyQNCIWCBTAPDQGG-UTLKBRERSA-N
MW363.50 g/mol
LogP3.67
Rot. Bonds15

About azane;(2S)-2-(dodecanoylamino)pentanedioic acid

azane;(2S)-2-(dodecanoylamino)pentanedioic acid (PubChem CID 173170599) has the molecular formula C17H37N3O5 and a molecular weight of 363.50 g/mol. Its IUPAC name is azane;(2S)-2-(dodecanoylamino)pentanedioic acid.

Molecular Properties

Compound Nameazane;(2S)-2-(dodecanoylamino)pentanedioic acid
PubChem CID173170599
Molecular FormulaC17H37N3O5
Molecular Weight363.50 g/mol
Exact Mass363.27
IUPAC Nameazane;(2S)-2-(dodecanoylamino)pentanedioic acid
SMILESCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O.N.N
InChIInChI=1S/C17H31NO5.2H3N/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);2*1H3/t14-;;/m0../s1
InChIKeyQNCIWCBTAPDQGG-UTLKBRERSA-N
XLogP3.67
TPSA173.70 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds15
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.50
LogP ≤ 53.67
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze azane;(2S)-2-(dodecanoylamino)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;(2S)-2-(dodecanoylamino)pentanedioic acid?
The IUPAC name of azane;(2S)-2-(dodecanoylamino)pentanedioic acid (CID 173170599) is azane;(2S)-2-(dodecanoylamino)pentanedioic acid.
What is the SMILES notation for azane;(2S)-2-(dodecanoylamino)pentanedioic acid?
The canonical SMILES for azane;(2S)-2-(dodecanoylamino)pentanedioic acid is CCCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O.N.N.
What is the InChIKey of azane;(2S)-2-(dodecanoylamino)pentanedioic acid?
The InChIKey is QNCIWCBTAPDQGG-UTLKBRERSA-N. The full InChI is InChI=1S/C17H31NO5.2H3N/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);2*1H3/t14-;;/m0../s1.
What are the key properties of azane;(2S)-2-(dodecanoylamino)pentanedioic acid?
azane;(2S)-2-(dodecanoylamino)pentanedioic acid has a molecular weight of 363.50 g/mol, XLogP of 3.67, 15 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2S)-2-(dodecanoylamino)pentanedioic acid is sourced from PubChem (CID 173170599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).