C17H37N3O5 — CID 173170599
azane;(2S)-2-(dodecanoylamino)pentanedioic acid (PubChem CID 173170599) has the molecular formula C17H37N3O5 and a molecular weight of 363.50 g/mol. Its IUPAC name is azane;(2S)-2-(dodecanoylamino)pentanedioic acid.
| Compound Name | azane;(2S)-2-(dodecanoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 173170599 |
| Molecular Formula | C17H37N3O5 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | azane;(2S)-2-(dodecanoylamino)pentanedioic acid |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O.N.N |
| InChI | InChI=1S/C17H31NO5.2H3N/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);2*1H3/t14-;;/m0../s1 |
| InChIKey | QNCIWCBTAPDQGG-UTLKBRERSA-N |
| XLogP | 3.67 |
| TPSA | 173.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|