C21H42N2O6 — CID 175329690
2-aminoethanol;2-(tetradecanoylamino)pentanedioic acid (PubChem CID 175329690) has the molecular formula C21H42N2O6 and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-aminoethanol;2-(tetradecanoylamino)pentanedioic acid.
| Compound Name | 2-aminoethanol;2-(tetradecanoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 175329690 |
| Molecular Formula | C21H42N2O6 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | 2-aminoethanol;2-(tetradecanoylamino)pentanedioic acid |
| SMILES | CCCCCCCCCCCCCC(=O)NC(CCC(=O)O)C(=O)O.NCCO |
| InChI | InChI=1S/C19H35NO5.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16(19(24)25)14-15-18(22)23;3-1-2-4/h16H,2-15H2,1H3,(H,20,21)(H,22,23)(H,24,25);4H,1-3H2 |
| InChIKey | MYYKNATVMZMHCE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|