C29H57N3O7 — CID 175413316
2-(dodecanoylamino)pentanedioic acid;bis(hexanamide) (PubChem CID 175413316) has the molecular formula C29H57N3O7 and a molecular weight of 559.79 g/mol. Its IUPAC name is 2-(dodecanoylamino)pentanedioic acid;bis(hexanamide).
| Compound Name | 2-(dodecanoylamino)pentanedioic acid;bis(hexanamide) |
|---|---|
| PubChem CID | 175413316 |
| Molecular Formula | C29H57N3O7 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.42 |
| IUPAC Name | 2-(dodecanoylamino)pentanedioic acid;bis(hexanamide) |
| SMILES | CCCCCC(N)=O.CCCCCC(N)=O.CCCCCCCCCCCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H31NO5.2C6H13NO/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;2*1-2-3-4-5-6(7)8/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);2*2-5H2,1H3,(H2,7,8) |
| InChIKey | IHMQLSNSJZJDTG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 189.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|