C19H36N2O4 — CID 18318649
5-amino-5-oxo-2-(tetradecanoylamino)pentanoic acid (PubChem CID 18318649) has the molecular formula C19H36N2O4 and a molecular weight of 356.51 g/mol. Its IUPAC name is 5-amino-5-oxo-2-(tetradecanoylamino)pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-(tetradecanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 18318649 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 5-amino-5-oxo-2-(tetradecanoylamino)pentanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H36N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-18(23)21-16(19(24)25)14-15-17(20)22/h16H,2-15H2,1H3,(H2,20,22)(H,21,23)(H,24,25) |
| InChIKey | GQCSFCKGCIEEJN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|