C17H28N4O8 — CID 22096663
5-amino-2-[[7-[(4-amino-1-carboxy-4-oxobutyl)amino]-7-oxoheptanoyl]amino]-5-oxopentanoic acid (PubChem CID 22096663) has the molecular formula C17H28N4O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is 5-amino-2-[[7-[(4-amino-1-carboxy-4-oxobutyl)amino]-7-oxoheptanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[7-[(4-amino-1-carboxy-4-oxobutyl)amino]-7-oxoheptanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22096663 |
| Molecular Formula | C17H28N4O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 5-amino-2-[[7-[(4-amino-1-carboxy-4-oxobutyl)amino]-7-oxoheptanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)CCCCCC(=O)NC(CCC(N)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H28N4O8/c18-12(22)8-6-10(16(26)27)20-14(24)4-2-1-3-5-15(25)21-11(17(28)29)7-9-13(19)23/h10-11H,1-9H2,(H2,18,22)(H2,19,23)(H,20,24)(H,21,25)(H,26,27)(H,28,29) |
| InChIKey | QWWKRUTYAIRQQA-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 218.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|