C24H44N2O4 — CID 123328300
5-amino-2-(nonadec-9-enoylamino)-5-oxopentanoic acid (PubChem CID 123328300) has the molecular formula C24H44N2O4 and a molecular weight of 424.63 g/mol. Its IUPAC name is 5-amino-2-(nonadec-9-enoylamino)-5-oxopentanoic acid.
| Compound Name | 5-amino-2-(nonadec-9-enoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123328300 |
| Molecular Formula | C24H44N2O4 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 5-amino-2-(nonadec-9-enoylamino)-5-oxopentanoic acid |
| SMILES | CCCCCCCCCC=CCCCCCCCC(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H44N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(28)26-21(24(29)30)19-20-22(25)27/h10-11,21H,2-9,12-20H2,1H3,(H2,25,27)(H,26,28)(H,29,30) |
| InChIKey | JRGBTPFJXDELLS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|