C22H40N2O4 — CID 171116793
(2S)-5-amino-2-[[(Z)-heptadec-9-enoyl]amino]-5-oxopentanoic acid (PubChem CID 171116793) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(Z)-heptadec-9-enoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(Z)-heptadec-9-enoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 171116793 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (2S)-5-amino-2-[[(Z)-heptadec-9-enoyl]amino]-5-oxopentanoic acid |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H40N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21(26)24-19(22(27)28)17-18-20(23)25/h8-9,19H,2-7,10-18H2,1H3,(H2,23,25)(H,24,26)(H,27,28)/b9-8-/t19-/m0/s1 |
| InChIKey | IHGQJBAVGVIDGR-QWUACUGRSA-N |
| XLogP | 4.47 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|