C25H46N2O4 — CID 171116799
(2S)-5-amino-2-[[(Z)-icos-11-enoyl]amino]-5-oxopentanoic acid (PubChem CID 171116799) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(Z)-icos-11-enoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(Z)-icos-11-enoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 171116799 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (2S)-5-amino-2-[[(Z)-icos-11-enoyl]amino]-5-oxopentanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H46N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(29)27-22(25(30)31)20-21-23(26)28/h9-10,22H,2-8,11-21H2,1H3,(H2,26,28)(H,27,29)(H,30,31)/b10-9-/t22-/m0/s1 |
| InChIKey | XIMBHGPKJTYMGN-DYYZXQNHSA-N |
| XLogP | 5.64 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|