C21H40N2O3 — CID 171116958
(2S)-5-amino-2-[[(Z)-hexadec-9-enoyl]amino]pentanoic acid (PubChem CID 171116958) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(Z)-hexadec-9-enoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(Z)-hexadec-9-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 171116958 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | (2S)-5-amino-2-[[(Z)-hexadec-9-enoyl]amino]pentanoic acid |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCCN)C(=O)O |
| InChI | InChI=1S/C21H40N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20(24)23-19(21(25)26)16-15-18-22/h7-8,19H,2-6,9-18,22H2,1H3,(H,23,24)(H,25,26)/b8-7-/t19-/m0/s1 |
| InChIKey | AQOAOHQXWWEUBM-FQQSSWHASA-N |
| XLogP | 4.55 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|