C24H46N2O3 — CID 142402349
(2S)-6-amino-2-[[(Z)-18-deuteriooctadec-9-enoyl]amino]hexanoic acid (PubChem CID 142402349) has the molecular formula C24H46N2O3 and a molecular weight of 411.65 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(Z)-18-deuteriooctadec-9-enoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(Z)-18-deuteriooctadec-9-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 142402349 |
| Molecular Formula | C24H46N2O3 |
| Molecular Weight | 411.65 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | (2S)-6-amino-2-[[(Z)-18-deuteriooctadec-9-enoyl]amino]hexanoic acid |
| SMILES | [2H]CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C24H46N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23(27)26-22(24(28)29)19-17-18-21-25/h9-10,22H,2-8,11-21,25H2,1H3,(H,26,27)(H,28,29)/b10-9-/t22-/m0/s1/i1D |
| InChIKey | JJUHWJQHBPFMJW-FJPKBJCDSA-N |
| XLogP | 5.72 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|