C20H38N2O3 — CID 171116957
(2S)-5-amino-2-[[(Z)-pentadec-9-enoyl]amino]pentanoic acid (PubChem CID 171116957) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(Z)-pentadec-9-enoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(Z)-pentadec-9-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 171116957 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (2S)-5-amino-2-[[(Z)-pentadec-9-enoyl]amino]pentanoic acid |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCCN)C(=O)O |
| InChI | InChI=1S/C20H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-19(23)22-18(20(24)25)15-14-17-21/h6-7,18H,2-5,8-17,21H2,1H3,(H,22,23)(H,24,25)/b7-6-/t18-/m0/s1 |
| InChIKey | REIJNAVPPQVBLP-MJRGOJFPSA-N |
| XLogP | 4.16 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|