C14H30N2O3S — CID 174384017
6-amino-2-(octanoylamino)hexanoic acid;sulfane (PubChem CID 174384017) has the molecular formula C14H30N2O3S and a molecular weight of 306.47 g/mol. Its IUPAC name is 6-amino-2-(octanoylamino)hexanoic acid;sulfane.
| Compound Name | 6-amino-2-(octanoylamino)hexanoic acid;sulfane |
|---|---|
| PubChem CID | 174384017 |
| Molecular Formula | C14H30N2O3S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 6-amino-2-(octanoylamino)hexanoic acid;sulfane |
| SMILES | CCCCCCCC(=O)NC(CCCCN)C(=O)O.S |
| InChI | InChI=1S/C14H28N2O3.H2S/c1-2-3-4-5-6-10-13(17)16-12(14(18)19)9-7-8-11-15;/h12H,2-11,15H2,1H3,(H,16,17)(H,18,19);1H2 |
| InChIKey | FXGNJGWOZMXSOR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|