C24H49N3O4 — CID 174328411
6-amino-2-(hexanoylamino)hexanoic acid;dodecanamide (PubChem CID 174328411) has the molecular formula C24H49N3O4 and a molecular weight of 443.67 g/mol. Its IUPAC name is 6-amino-2-(hexanoylamino)hexanoic acid;dodecanamide.
| Compound Name | 6-amino-2-(hexanoylamino)hexanoic acid;dodecanamide |
|---|---|
| PubChem CID | 174328411 |
| Molecular Formula | C24H49N3O4 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.37 |
| IUPAC Name | 6-amino-2-(hexanoylamino)hexanoic acid;dodecanamide |
| SMILES | CCCCCC(=O)NC(CCCCN)C(=O)O.CCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C12H24N2O3.C12H25NO/c1-2-3-4-8-11(15)14-10(12(16)17)7-5-6-9-13;1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10H,2-9,13H2,1H3,(H,14,15)(H,16,17);2-11H2,1H3,(H2,13,14) |
| InChIKey | FVVWGTGAOQOUGB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|