C23H46N4O6 — CID 174862072
5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2,6-diaminohexanoic acid (PubChem CID 174862072) has the molecular formula C23H46N4O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is 5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2,6-diaminohexanoic acid.
| Compound Name | 5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 174862072 |
| Molecular Formula | C23H46N4O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.34 |
| IUPAC Name | 5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2,6-diaminohexanoic acid |
| SMILES | CCCCCCCCCCCC(=O)NC(CCC(N)=O)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C17H32N2O4.C6H14N2O2/c1-2-3-4-5-6-7-8-9-10-11-16(21)19-14(17(22)23)12-13-15(18)20;7-4-2-1-3-5(8)6(9)10/h14H,2-13H2,1H3,(H2,18,20)(H,19,21)(H,22,23);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | GYOXOGVIQBRRGU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 198.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|