C19H39N3O5 — CID 87876051
(2S)-2-(decanoylamino)propanoic acid;2,6-diaminohexanoic acid (PubChem CID 87876051) has the molecular formula C19H39N3O5 and a molecular weight of 389.54 g/mol. Its IUPAC name is (2S)-2-(decanoylamino)propanoic acid;2,6-diaminohexanoic acid.
| Compound Name | (2S)-2-(decanoylamino)propanoic acid;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 87876051 |
| Molecular Formula | C19H39N3O5 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (2S)-2-(decanoylamino)propanoic acid;2,6-diaminohexanoic acid |
| SMILES | CCCCCCCCCC(=O)N[C@@H](C)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C13H25NO3.C6H14N2O2/c1-3-4-5-6-7-8-9-10-12(15)14-11(2)13(16)17;7-4-2-1-3-5(8)6(9)10/h11H,3-10H2,1-2H3,(H,14,15)(H,16,17);5H,1-4,7-8H2,(H,9,10)/t11-;/m0./s1 |
| InChIKey | BPHMXNNZBWUPLU-MERQFXBCSA-N |
| XLogP | 2.24 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|