C18H39N3O3 — CID 87964138
2,6-diaminohexanoic acid;dodecanamide (PubChem CID 87964138) has the molecular formula C18H39N3O3 and a molecular weight of 345.53 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;dodecanamide.
| Compound Name | 2,6-diaminohexanoic acid;dodecanamide |
|---|---|
| PubChem CID | 87964138 |
| Molecular Formula | C18H39N3O3 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | 2,6-diaminohexanoic acid;dodecanamide |
| SMILES | CCCCCCCCCCCC(N)=O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C12H25NO.C6H14N2O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;7-4-2-1-3-5(8)6(9)10/h2-11H2,1H3,(H2,13,14);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | XDHIQLXDCXVVIJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|