C16H34N2O4 — CID 87982832
decanoic acid;(2S)-2,6-diaminohexanoic acid (PubChem CID 87982832) has the molecular formula C16H34N2O4 and a molecular weight of 318.46 g/mol. Its IUPAC name is decanoic acid;(2S)-2,6-diaminohexanoic acid.
| Compound Name | decanoic acid;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 87982832 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | decanoic acid;(2S)-2,6-diaminohexanoic acid |
| SMILES | CCCCCCCCCC(=O)O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H20O2.C6H14N2O2/c1-2-3-4-5-6-7-8-9-10(11)12;7-4-2-1-3-5(8)6(9)10/h2-9H2,1H3,(H,11,12);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | AWCMDQRPTDOBPC-ZSCHJXSPSA-N |
| XLogP | 2.74 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|