About nonan-1-amine;octanoic acid
nonan-1-amine;octanoic acid (PubChem CID 173305538) has the molecular formula C17H37NO2
and a molecular weight of 287.49 g/mol. Its IUPAC name is nonan-1-amine;octanoic acid.
Molecular Properties
| Compound Name | nonan-1-amine;octanoic acid |
| PubChem CID | 173305538 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | nonan-1-amine;octanoic acid |
| SMILES | CCCCCCCC(=O)O.CCCCCCCCCN |
| InChI | InChI=1S/C9H21N.C8H16O2/c1-2-3-4-5-6-7-8-9-10;1-2-3-4-5-6-7-8(9)10/h2-10H2,1H3;2-7H2,1H3,(H,9,10) |
| InChIKey | LZVMFNHENSNEHV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-1-amine;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-1-amine;octanoic acid?
The IUPAC name of nonan-1-amine;octanoic acid (CID 173305538) is nonan-1-amine;octanoic acid.
What is the SMILES notation for nonan-1-amine;octanoic acid?
The canonical SMILES for nonan-1-amine;octanoic acid is CCCCCCCC(=O)O.CCCCCCCCCN.
What is the InChIKey of nonan-1-amine;octanoic acid?
The InChIKey is LZVMFNHENSNEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C8H16O2/c1-2-3-4-5-6-7-8-9-10;1-2-3-4-5-6-7-8(9)10/h2-10H2,1H3;2-7H2,1H3,(H,9,10).
What are the key properties of nonan-1-amine;octanoic acid?
nonan-1-amine;octanoic acid has a molecular weight of 287.49 g/mol, XLogP of 5.13, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-1-amine;octanoic acid is sourced from PubChem (CID 173305538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).