About 5-aminopentan-1-ol;octanoic acid
5-aminopentan-1-ol;octanoic acid (PubChem CID 21259313) has the molecular formula C13H29NO3
and a molecular weight of 247.38 g/mol. Its IUPAC name is 5-aminopentan-1-ol;octanoic acid.
Molecular Properties
| Compound Name | 5-aminopentan-1-ol;octanoic acid |
| PubChem CID | 21259313 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 5-aminopentan-1-ol;octanoic acid |
| SMILES | CCCCCCCC(=O)O.NCCCCCO |
| InChI | InChI=1S/C8H16O2.C5H13NO/c1-2-3-4-5-6-7-8(9)10;6-4-2-1-3-5-7/h2-7H2,1H3,(H,9,10);7H,1-6H2 |
| InChIKey | KSPUCNMTIYFUFD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-aminopentan-1-ol;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopentan-1-ol;octanoic acid?
The IUPAC name of 5-aminopentan-1-ol;octanoic acid (CID 21259313) is 5-aminopentan-1-ol;octanoic acid.
What is the SMILES notation for 5-aminopentan-1-ol;octanoic acid?
The canonical SMILES for 5-aminopentan-1-ol;octanoic acid is CCCCCCCC(=O)O.NCCCCCO.
What is the InChIKey of 5-aminopentan-1-ol;octanoic acid?
The InChIKey is KSPUCNMTIYFUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C5H13NO/c1-2-3-4-5-6-7-8(9)10;6-4-2-1-3-5-7/h2-7H2,1H3,(H,9,10);7H,1-6H2.
What are the key properties of 5-aminopentan-1-ol;octanoic acid?
5-aminopentan-1-ol;octanoic acid has a molecular weight of 247.38 g/mol, XLogP of 2.54, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopentan-1-ol;octanoic acid is sourced from PubChem (CID 21259313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).