About 18-hydroxyoctadecanoic acid;octadecanoic acid
18-hydroxyoctadecanoic acid;octadecanoic acid (PubChem CID 87989364) has the molecular formula C36H72O5
and a molecular weight of 584.97 g/mol. Its IUPAC name is 18-hydroxyoctadecanoic acid;octadecanoic acid.
Molecular Properties
| Compound Name | 18-hydroxyoctadecanoic acid;octadecanoic acid |
| PubChem CID | 87989364 |
| Molecular Formula | C36H72O5 |
| Molecular Weight | 584.97 g/mol |
| Exact Mass | 584.54 |
| IUPAC Name | 18-hydroxyoctadecanoic acid;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.O=C(O)CCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C18H36O3.C18H36O2/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h19H,1-17H2,(H,20,21);2-17H2,1H3,(H,19,20) |
| InChIKey | XDBQBLWGWJGJHR-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.97 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 18-hydroxyoctadecanoic acid;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-hydroxyoctadecanoic acid;octadecanoic acid?
The IUPAC name of 18-hydroxyoctadecanoic acid;octadecanoic acid (CID 87989364) is 18-hydroxyoctadecanoic acid;octadecanoic acid.
What is the SMILES notation for 18-hydroxyoctadecanoic acid;octadecanoic acid?
The canonical SMILES for 18-hydroxyoctadecanoic acid;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.O=C(O)CCCCCCCCCCCCCCCCCO.
What is the InChIKey of 18-hydroxyoctadecanoic acid;octadecanoic acid?
The InChIKey is XDBQBLWGWJGJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3.C18H36O2/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h19H,1-17H2,(H,20,21);2-17H2,1H3,(H,19,20).
What are the key properties of 18-hydroxyoctadecanoic acid;octadecanoic acid?
18-hydroxyoctadecanoic acid;octadecanoic acid has a molecular weight of 584.97 g/mol, XLogP of 11.64, 33 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 18-hydroxyoctadecanoic acid;octadecanoic acid is sourced from PubChem (CID 87989364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).