C24H50O4 — CID 87364102
dodecane-1,12-diol;dodecanoic acid (PubChem CID 87364102) has the molecular formula C24H50O4 and a molecular weight of 402.66 g/mol. Its IUPAC name is dodecane-1,12-diol;dodecanoic acid.
| Compound Name | dodecane-1,12-diol;dodecanoic acid |
|---|---|
| PubChem CID | 87364102 |
| Molecular Formula | C24H50O4 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | dodecane-1,12-diol;dodecanoic acid |
| SMILES | CCCCCCCCCCCC(=O)O.OCCCCCCCCCCCCO |
| InChI | InChI=1S/C12H24O2.C12H26O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;13-11-9-7-5-3-1-2-4-6-8-10-12-14/h2-11H2,1H3,(H,13,14);13-14H,1-12H2 |
| InChIKey | QGIALZCZPXCNON-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|