About decanoic acid;tetradecanoic acid
decanoic acid;tetradecanoic acid (PubChem CID 87611521) has the molecular formula C24H48O4
and a molecular weight of 400.64 g/mol. Its IUPAC name is decanoic acid;tetradecanoic acid.
Molecular Properties
| Compound Name | decanoic acid;tetradecanoic acid |
| PubChem CID | 87611521 |
| Molecular Formula | C24H48O4 |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | decanoic acid;tetradecanoic acid |
| SMILES | CCCCCCCCCC(=O)O.CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2.C10H20O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10(11)12/h2-13H2,1H3,(H,15,16);2-9H2,1H3,(H,11,12) |
| InChIKey | NYVNRFYXFHTPAP-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanoic acid;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoic acid;tetradecanoic acid?
The IUPAC name of decanoic acid;tetradecanoic acid (CID 87611521) is decanoic acid;tetradecanoic acid.
What is the SMILES notation for decanoic acid;tetradecanoic acid?
The canonical SMILES for decanoic acid;tetradecanoic acid is CCCCCCCCCC(=O)O.CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of decanoic acid;tetradecanoic acid?
The InChIKey is NYVNRFYXFHTPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C10H20O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10(11)12/h2-13H2,1H3,(H,15,16);2-9H2,1H3,(H,11,12).
What are the key properties of decanoic acid;tetradecanoic acid?
decanoic acid;tetradecanoic acid has a molecular weight of 400.64 g/mol, XLogP of 7.98, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanoic acid;tetradecanoic acid is sourced from PubChem (CID 87611521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).