About decanoic acid;bis(nonanoic acid)
decanoic acid;bis(nonanoic acid) (PubChem CID 159376136) has the molecular formula C28H56O6
and a molecular weight of 488.75 g/mol. Its IUPAC name is decanoic acid;bis(nonanoic acid).
Molecular Properties
| Compound Name | decanoic acid;bis(nonanoic acid) |
| PubChem CID | 159376136 |
| Molecular Formula | C28H56O6 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.41 |
| IUPAC Name | decanoic acid;bis(nonanoic acid) |
| SMILES | CCCCCCCCC(=O)O.CCCCCCCCC(=O)O.CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H20O2.2C9H18O2/c1-2-3-4-5-6-7-8-9-10(11)12;2*1-2-3-4-5-6-7-8-9(10)11/h2-9H2,1H3,(H,11,12);2*2-8H2,1H3,(H,10,11) |
| InChIKey | LKILUVVVUXVCIC-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanoic acid;bis(nonanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoic acid;bis(nonanoic acid)?
The IUPAC name of decanoic acid;bis(nonanoic acid) (CID 159376136) is decanoic acid;bis(nonanoic acid).
What is the SMILES notation for decanoic acid;bis(nonanoic acid)?
The canonical SMILES for decanoic acid;bis(nonanoic acid) is CCCCCCCCC(=O)O.CCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.
What is the InChIKey of decanoic acid;bis(nonanoic acid)?
The InChIKey is LKILUVVVUXVCIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.2C9H18O2/c1-2-3-4-5-6-7-8-9-10(11)12;2*1-2-3-4-5-6-7-8-9(10)11/h2-9H2,1H3,(H,11,12);2*2-8H2,1H3,(H,10,11).
What are the key properties of decanoic acid;bis(nonanoic acid)?
decanoic acid;bis(nonanoic acid) has a molecular weight of 488.75 g/mol, XLogP of 8.85, 22 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decanoic acid;bis(nonanoic acid) is sourced from PubChem (CID 159376136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).