About decanedioic acid;nonane
decanedioic acid;nonane (PubChem CID 25154161) has the molecular formula C19H38O4
and a molecular weight of 330.51 g/mol. Its IUPAC name is decanedioic acid;nonane.
Molecular Properties
| Compound Name | decanedioic acid;nonane |
| PubChem CID | 25154161 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | decanedioic acid;nonane |
| SMILES | CCCCCCCCC.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.C9H20/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-3-5-7-9-8-6-4-2/h1-8H2,(H,11,12)(H,13,14);3-9H2,1-2H3 |
| InChIKey | TVMNODRMUTWTNX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanedioic acid;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanedioic acid;nonane?
The IUPAC name of decanedioic acid;nonane (CID 25154161) is decanedioic acid;nonane.
What is the SMILES notation for decanedioic acid;nonane?
The canonical SMILES for decanedioic acid;nonane is CCCCCCCCC.O=C(O)CCCCCCCCC(=O)O.
What is the InChIKey of decanedioic acid;nonane?
The InChIKey is TVMNODRMUTWTNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.C9H20/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-3-5-7-9-8-6-4-2/h1-8H2,(H,11,12)(H,13,14);3-9H2,1-2H3.
What are the key properties of decanedioic acid;nonane?
decanedioic acid;nonane has a molecular weight of 330.51 g/mol, XLogP of 6.03, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanedioic acid;nonane is sourced from PubChem (CID 25154161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).