About octadecanoic acid;pentadecan-1-amine
octadecanoic acid;pentadecan-1-amine (PubChem CID 174740594) has the molecular formula C33H69NO2
and a molecular weight of 511.92 g/mol. Its IUPAC name is octadecanoic acid;pentadecan-1-amine.
Molecular Properties
| Compound Name | octadecanoic acid;pentadecan-1-amine |
| PubChem CID | 174740594 |
| Molecular Formula | C33H69NO2 |
| Molecular Weight | 511.92 g/mol |
| Exact Mass | 511.53 |
| IUPAC Name | octadecanoic acid;pentadecan-1-amine |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCN |
| InChI | InChI=1S/C18H36O2.C15H33N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16/h2-17H2,1H3,(H,19,20);2-16H2,1H3 |
| InChIKey | CZTHBTRZOJACNN-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.92 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanoic acid;pentadecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoic acid;pentadecan-1-amine?
The IUPAC name of octadecanoic acid;pentadecan-1-amine (CID 174740594) is octadecanoic acid;pentadecan-1-amine.
What is the SMILES notation for octadecanoic acid;pentadecan-1-amine?
The canonical SMILES for octadecanoic acid;pentadecan-1-amine is CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCN.
What is the InChIKey of octadecanoic acid;pentadecan-1-amine?
The InChIKey is CZTHBTRZOJACNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C15H33N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16/h2-17H2,1H3,(H,19,20);2-16H2,1H3.
What are the key properties of octadecanoic acid;pentadecan-1-amine?
octadecanoic acid;pentadecan-1-amine has a molecular weight of 511.92 g/mol, XLogP of 11.37, 29 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoic acid;pentadecan-1-amine is sourced from PubChem (CID 174740594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).