About dodecan-1-amine;octadec-9-enoic acid
dodecan-1-amine;octadec-9-enoic acid (PubChem CID 71446756) has the molecular formula C30H61NO2
and a molecular weight of 467.82 g/mol. Its IUPAC name is dodecan-1-amine;octadec-9-enoic acid.
Molecular Properties
| Compound Name | dodecan-1-amine;octadec-9-enoic acid |
| PubChem CID | 71446756 |
| Molecular Formula | C30H61NO2 |
| Molecular Weight | 467.82 g/mol |
| Exact Mass | 467.47 |
| IUPAC Name | dodecan-1-amine;octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.CCCCCCCCCCCCN |
| InChI | InChI=1S/C18H34O2.C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-13H2,1H3 |
| InChIKey | YGNMKCIQDOADAV-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.82 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dodecan-1-amine;octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-1-amine;octadec-9-enoic acid?
The IUPAC name of dodecan-1-amine;octadec-9-enoic acid (CID 71446756) is dodecan-1-amine;octadec-9-enoic acid.
What is the SMILES notation for dodecan-1-amine;octadec-9-enoic acid?
The canonical SMILES for dodecan-1-amine;octadec-9-enoic acid is CCCCCCCCC=CCCCCCCCC(=O)O.CCCCCCCCCCCCN.
What is the InChIKey of dodecan-1-amine;octadec-9-enoic acid?
The InChIKey is YGNMKCIQDOADAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2.C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-13H2,1H3.
What are the key properties of dodecan-1-amine;octadec-9-enoic acid?
dodecan-1-amine;octadec-9-enoic acid has a molecular weight of 467.82 g/mol, XLogP of 9.97, 25 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-1-amine;octadec-9-enoic acid is sourced from PubChem (CID 71446756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).