(E)-hexadec-8-enoic acid

C16H30O2 — CID 6430788

IUPAC(E)-hexadec-8-enoic acid
SMILESCCCCCCC/C=C/CCCCCCC(=O)O
InChIInChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h8-9H,2-7,10-15H2,1H3,(H,17,18)/b9-8+
InChIKeyNJTVGRDDFBKQLU-CMDGGOBGSA-N
MW254.41 g/mol
LogP5.33
Rot. Bonds13

About (E)-hexadec-8-enoic acid

(E)-hexadec-8-enoic acid (PubChem CID 6430788) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (E)-hexadec-8-enoic acid.

Molecular Properties

Compound Name(E)-hexadec-8-enoic acid
PubChem CID6430788
Molecular FormulaC16H30O2
Molecular Weight254.41 g/mol
Exact Mass254.22
IUPAC Name(E)-hexadec-8-enoic acid
SMILESCCCCCCC/C=C/CCCCCCC(=O)O
InChIInChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h8-9H,2-7,10-15H2,1H3,(H,17,18)/b9-8+
InChIKeyNJTVGRDDFBKQLU-CMDGGOBGSA-N
XLogP5.33
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms18
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500254.41
LogP ≤ 55.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-hexadec-8-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-hexadec-8-enoic acid?
The IUPAC name of (E)-hexadec-8-enoic acid (CID 6430788) is (E)-hexadec-8-enoic acid.
What is the SMILES notation for (E)-hexadec-8-enoic acid?
The canonical SMILES for (E)-hexadec-8-enoic acid is CCCCCCC/C=C/CCCCCCC(=O)O.
What is the InChIKey of (E)-hexadec-8-enoic acid?
The InChIKey is NJTVGRDDFBKQLU-CMDGGOBGSA-N. The full InChI is InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h8-9H,2-7,10-15H2,1H3,(H,17,18)/b9-8+.
What are the key properties of (E)-hexadec-8-enoic acid?
(E)-hexadec-8-enoic acid has a molecular weight of 254.41 g/mol, XLogP of 5.33, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hexadec-8-enoic acid is sourced from PubChem (CID 6430788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).