About decanoic acid;octadec-9-enoic acid
decanoic acid;octadec-9-enoic acid (PubChem CID 173212255) has the molecular formula C28H54O4
and a molecular weight of 454.74 g/mol. Its IUPAC name is decanoic acid;octadec-9-enoic acid.
Molecular Properties
| Compound Name | decanoic acid;octadec-9-enoic acid |
| PubChem CID | 173212255 |
| Molecular Formula | C28H54O4 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.40 |
| IUPAC Name | decanoic acid;octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C10H20O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10(11)12/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-9H2,1H3,(H,11,12) |
| InChIKey | UKWIGEGTQKXANU-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze decanoic acid;octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoic acid;octadec-9-enoic acid?
The IUPAC name of decanoic acid;octadec-9-enoic acid (CID 173212255) is decanoic acid;octadec-9-enoic acid.
What is the SMILES notation for decanoic acid;octadec-9-enoic acid?
The canonical SMILES for decanoic acid;octadec-9-enoic acid is CCCCCCCCC=CCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.
What is the InChIKey of decanoic acid;octadec-9-enoic acid?
The InChIKey is UKWIGEGTQKXANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2.C10H20O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10(11)12/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-9H2,1H3,(H,11,12).
What are the key properties of decanoic acid;octadec-9-enoic acid?
decanoic acid;octadec-9-enoic acid has a molecular weight of 454.74 g/mol, XLogP of 9.32, 23 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanoic acid;octadec-9-enoic acid is sourced from PubChem (CID 173212255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).