About docosanoic acid;(Z)-icos-9-enoic acid
docosanoic acid;(Z)-icos-9-enoic acid (PubChem CID 159601642) has the molecular formula C42H82O4
and a molecular weight of 651.11 g/mol. Its IUPAC name is docosanoic acid;(Z)-icos-9-enoic acid.
Molecular Properties
| Compound Name | docosanoic acid;(Z)-icos-9-enoic acid |
| PubChem CID | 159601642 |
| Molecular Formula | C42H82O4 |
| Molecular Weight | 651.11 g/mol |
| Exact Mass | 650.62 |
| IUPAC Name | docosanoic acid;(Z)-icos-9-enoic acid |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H44O2.C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-21H2,1H3,(H,23,24);11-12H,2-10,13-19H2,1H3,(H,21,22)/b;12-11- |
| InChIKey | MLOCEVRFZHPNPT-LATCQUSVSA-N |
| XLogP | 14.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.11 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze docosanoic acid;(Z)-icos-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosanoic acid;(Z)-icos-9-enoic acid?
The IUPAC name of docosanoic acid;(Z)-icos-9-enoic acid (CID 159601642) is docosanoic acid;(Z)-icos-9-enoic acid.
What is the SMILES notation for docosanoic acid;(Z)-icos-9-enoic acid?
The canonical SMILES for docosanoic acid;(Z)-icos-9-enoic acid is CCCCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of docosanoic acid;(Z)-icos-9-enoic acid?
The InChIKey is MLOCEVRFZHPNPT-LATCQUSVSA-N. The full InChI is InChI=1S/C22H44O2.C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-21H2,1H3,(H,23,24);11-12H,2-10,13-19H2,1H3,(H,21,22)/b;12-11-.
What are the key properties of docosanoic acid;(Z)-icos-9-enoic acid?
docosanoic acid;(Z)-icos-9-enoic acid has a molecular weight of 651.11 g/mol, XLogP of 14.78, 37 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for docosanoic acid;(Z)-icos-9-enoic acid is sourced from PubChem (CID 159601642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).