C39H78N2O4 — CID 173374697
bis(octadec-9-enoic acid);propane-1,3-diamine (PubChem CID 173374697) has the molecular formula C39H78N2O4 and a molecular weight of 639.06 g/mol. Its IUPAC name is bis(octadec-9-enoic acid);propane-1,3-diamine.
| Compound Name | bis(octadec-9-enoic acid);propane-1,3-diamine |
|---|---|
| PubChem CID | 173374697 |
| Molecular Formula | C39H78N2O4 |
| Molecular Weight | 639.06 g/mol |
| Exact Mass | 638.60 |
| IUPAC Name | bis(octadec-9-enoic acid);propane-1,3-diamine |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.CCCCCCCCC=CCCCCCCCC(=O)O.NCCCN |
| InChI | InChI=1S/2C18H34O2.C3H10N2/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;4-2-1-3-5/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);1-5H2 |
| InChIKey | HDLBOHGQTWKFRG-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.06 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|