About hexadecanoic acid;pentan-1-amine
hexadecanoic acid;pentan-1-amine (PubChem CID 161401164) has the molecular formula C21H45NO2
and a molecular weight of 343.60 g/mol. Its IUPAC name is hexadecanoic acid;pentan-1-amine.
Molecular Properties
| Compound Name | hexadecanoic acid;pentan-1-amine |
| PubChem CID | 161401164 |
| Molecular Formula | C21H45NO2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.35 |
| IUPAC Name | hexadecanoic acid;pentan-1-amine |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.CCCCCN |
| InChI | InChI=1S/C16H32O2.C5H13N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-2-3-4-5-6/h2-15H2,1H3,(H,17,18);2-6H2,1H3 |
| InChIKey | VUGINVLSGGXHKE-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoic acid;pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoic acid;pentan-1-amine?
The IUPAC name of hexadecanoic acid;pentan-1-amine (CID 161401164) is hexadecanoic acid;pentan-1-amine.
What is the SMILES notation for hexadecanoic acid;pentan-1-amine?
The canonical SMILES for hexadecanoic acid;pentan-1-amine is CCCCCCCCCCCCCCCC(=O)O.CCCCCN.
What is the InChIKey of hexadecanoic acid;pentan-1-amine?
The InChIKey is VUGINVLSGGXHKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.C5H13N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-2-3-4-5-6/h2-15H2,1H3,(H,17,18);2-6H2,1H3.
What are the key properties of hexadecanoic acid;pentan-1-amine?
hexadecanoic acid;pentan-1-amine has a molecular weight of 343.60 g/mol, XLogP of 6.69, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoic acid;pentan-1-amine is sourced from PubChem (CID 161401164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).