About decan-1-amine;tetradecanoic acid
decan-1-amine;tetradecanoic acid (PubChem CID 158474246) has the molecular formula C24H51NO2
and a molecular weight of 385.68 g/mol. Its IUPAC name is decan-1-amine;tetradecanoic acid.
Molecular Properties
| Compound Name | decan-1-amine;tetradecanoic acid |
| PubChem CID | 158474246 |
| Molecular Formula | C24H51NO2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.39 |
| IUPAC Name | decan-1-amine;tetradecanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)O.CCCCCCCCCCN |
| InChI | InChI=1S/C14H28O2.C10H23N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10-11/h2-13H2,1H3,(H,15,16);2-11H2,1H3 |
| InChIKey | HGSUCBSCEHDRLS-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-1-amine;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-amine;tetradecanoic acid?
The IUPAC name of decan-1-amine;tetradecanoic acid (CID 158474246) is decan-1-amine;tetradecanoic acid.
What is the SMILES notation for decan-1-amine;tetradecanoic acid?
The canonical SMILES for decan-1-amine;tetradecanoic acid is CCCCCCCCCCCCCC(=O)O.CCCCCCCCCCN.
What is the InChIKey of decan-1-amine;tetradecanoic acid?
The InChIKey is HGSUCBSCEHDRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C10H23N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10-11/h2-13H2,1H3,(H,15,16);2-11H2,1H3.
What are the key properties of decan-1-amine;tetradecanoic acid?
decan-1-amine;tetradecanoic acid has a molecular weight of 385.68 g/mol, XLogP of 7.86, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-amine;tetradecanoic acid is sourced from PubChem (CID 158474246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).