decan-1-amine;tetradecanoic acid

C24H51NO2 — CID 158474246

IUPACdecan-1-amine;tetradecanoic acid
SMILESCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCN
InChIInChI=1S/C14H28O2.C10H23N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10-11/h2-13H2,1H3,(H,15,16);2-11H2,1H3
InChIKeyHGSUCBSCEHDRLS-UHFFFAOYSA-N
MW385.68 g/mol
LogP7.86
Rot. Bonds20

About decan-1-amine;tetradecanoic acid

decan-1-amine;tetradecanoic acid (PubChem CID 158474246) has the molecular formula C24H51NO2 and a molecular weight of 385.68 g/mol. Its IUPAC name is decan-1-amine;tetradecanoic acid.

Molecular Properties

Compound Namedecan-1-amine;tetradecanoic acid
PubChem CID158474246
Molecular FormulaC24H51NO2
Molecular Weight385.68 g/mol
Exact Mass385.39
IUPAC Namedecan-1-amine;tetradecanoic acid
SMILESCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCN
InChIInChI=1S/C14H28O2.C10H23N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10-11/h2-13H2,1H3,(H,15,16);2-11H2,1H3
InChIKeyHGSUCBSCEHDRLS-UHFFFAOYSA-N
XLogP7.86
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds20
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500385.68
LogP ≤ 57.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze decan-1-amine;tetradecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of decan-1-amine;tetradecanoic acid?
The IUPAC name of decan-1-amine;tetradecanoic acid (CID 158474246) is decan-1-amine;tetradecanoic acid.
What is the SMILES notation for decan-1-amine;tetradecanoic acid?
The canonical SMILES for decan-1-amine;tetradecanoic acid is CCCCCCCCCCCCCC(=O)O.CCCCCCCCCCN.
What is the InChIKey of decan-1-amine;tetradecanoic acid?
The InChIKey is HGSUCBSCEHDRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C10H23N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10-11/h2-13H2,1H3,(H,15,16);2-11H2,1H3.
What are the key properties of decan-1-amine;tetradecanoic acid?
decan-1-amine;tetradecanoic acid has a molecular weight of 385.68 g/mol, XLogP of 7.86, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-amine;tetradecanoic acid is sourced from PubChem (CID 158474246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).