C27H49N3O6 — CID 67531425
(2S)-2-amino-3-phenylpropanoic acid;(2S)-2,6-diaminohexanoic acid;dodecanoic acid (PubChem CID 67531425) has the molecular formula C27H49N3O6 and a molecular weight of 511.70 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;(2S)-2,6-diaminohexanoic acid;dodecanoic acid.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;(2S)-2,6-diaminohexanoic acid;dodecanoic acid |
|---|---|
| PubChem CID | 67531425 |
| Molecular Formula | C27H49N3O6 |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.36 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;(2S)-2,6-diaminohexanoic acid;dodecanoic acid |
| SMILES | CCCCCCCCCCCC(=O)O.NCCCC[C@H](N)C(=O)O.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H24O2.C9H11NO2.C6H14N2O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;10-8(9(11)12)6-7-4-2-1-3-5-7;7-4-2-1-3-5(8)6(9)10/h2-11H2,1H3,(H,13,14);1-5,8H,6,10H2,(H,11,12);5H,1-4,7-8H2,(H,9,10)/t;8-;5-/m.00/s1 |
| InChIKey | KUFUEMROPNMFRA-GNRKDIJTSA-N |
| XLogP | 4.16 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|