C18H29N3O8 — CID 68766473
4-aminobutanoic acid;(2S)-2-aminopentanedioic acid;(2S)-2-amino-3-phenylpropanoic acid (PubChem CID 68766473) has the molecular formula C18H29N3O8 and a molecular weight of 415.44 g/mol. Its IUPAC name is 4-aminobutanoic acid;(2S)-2-aminopentanedioic acid;(2S)-2-amino-3-phenylpropanoic acid.
| Compound Name | 4-aminobutanoic acid;(2S)-2-aminopentanedioic acid;(2S)-2-amino-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 68766473 |
| Molecular Formula | C18H29N3O8 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-aminobutanoic acid;(2S)-2-aminopentanedioic acid;(2S)-2-amino-3-phenylpropanoic acid |
| SMILES | NCCCC(=O)O.N[C@@H](CCC(=O)O)C(=O)O.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C5H9NO4.C4H9NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;6-3(5(9)10)1-2-4(7)8;5-3-1-2-4(6)7/h1-5,8H,6,10H2,(H,11,12);3H,1-2,6H2,(H,7,8)(H,9,10);1-3,5H2,(H,6,7)/t8-;3-;/m00./s1 |
| InChIKey | GPPXBCGKPKCZIE-NJVNFBHUSA-N |
| XLogP | -0.29 |
| TPSA | 227.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |