C15H25N3O4 — CID 157149323
(2S)-2-amino-3-phenylpropanoic acid;(2R)-2,6-diaminohexanoic acid (PubChem CID 157149323) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;(2R)-2,6-diaminohexanoic acid.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;(2R)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 157149323 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;(2R)-2,6-diaminohexanoic acid |
| SMILES | NCCCC[C@@H](N)C(=O)O.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H14N2O2/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-4-2-1-3-5(8)6(9)10/h1-5,8H,6,10H2,(H,11,12);5H,1-4,7-8H2,(H,9,10)/t8-;5-/m01/s1 |
| InChIKey | ALBODLTZUXKBGZ-RERSEOJSSA-N |
| XLogP | 0.17 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|