C18H32N4O8 — CID 135206229
2-amino-3-(4-hydroxyphenyl)propanoic acid;2-amino-3-hydroxypropanoic acid;2,6-diaminohexanoic acid (PubChem CID 135206229) has the molecular formula C18H32N4O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;2-amino-3-hydroxypropanoic acid;2,6-diaminohexanoic acid.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;2-amino-3-hydroxypropanoic acid;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 135206229 |
| Molecular Formula | C18H32N4O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;2-amino-3-hydroxypropanoic acid;2,6-diaminohexanoic acid |
| SMILES | NC(CO)C(=O)O.NC(Cc1ccc(O)cc1)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C9H11NO3.C6H14N2O2.C3H7NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;7-4-2-1-3-5(8)6(9)10;4-2(1-5)3(6)7/h1-4,8,11H,5,10H2,(H,12,13);5H,1-4,7-8H2,(H,9,10);2,5H,1,4H2,(H,6,7) |
| InChIKey | ISKXVHAICXXNTJ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 256.44 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|