C9H13NO5 — CID 87135815
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrogen peroxide (PubChem CID 87135815) has the molecular formula C9H13NO5 and a molecular weight of 215.21 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrogen peroxide.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrogen peroxide |
|---|---|
| PubChem CID | 87135815 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrogen peroxide |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O.OO |
| InChI | InChI=1S/C9H11NO3.H2O2/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-2/h1-4,8,11H,5,10H2,(H,12,13);1-2H/t8-;/m0./s1 |
| InChIKey | SNWBYZQZZLQHKK-QRPNPIFTSA-N |
| XLogP | 0.36 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|