C9H13NNa2O4+2 — CID 170924153
disodium;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate (PubChem CID 170924153) has the molecular formula C9H13NNa2O4+2 and a molecular weight of 245.19 g/mol. Its IUPAC name is disodium;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate.
| Compound Name | disodium;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate |
|---|---|
| PubChem CID | 170924153 |
| Molecular Formula | C9H13NNa2O4+2 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | disodium;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O.O.[Na+].[Na+] |
| InChI | InChI=1S/C9H11NO3.2Na.H2O/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;;;/h1-4,8,11H,5,10H2,(H,12,13);;;1H2/q;2*+1;/t8-;;;/m0.../s1 |
| InChIKey | SMJHYQCAVHUILN-CZDIJEQGSA-N |
| XLogP | -6.47 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |