C9H13NO3Pb — CID 175006953
2-amino-3-(4-hydroxyphenyl)propanoic acid;λ2-plumbane (PubChem CID 175006953) has the molecular formula C9H13NO3Pb and a molecular weight of 390.41 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;λ2-plumbane.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;λ2-plumbane |
|---|---|
| PubChem CID | 175006953 |
| Molecular Formula | C9H13NO3Pb |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;λ2-plumbane |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)O.[PbH2] |
| InChI | InChI=1S/C9H11NO3.Pb.2H/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;;;/h1-4,8,11H,5,10H2,(H,12,13);;; |
| InChIKey | JSRHWUPWMILPMT-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |