C10H15N3O4 — CID 18402054
2-amino-3-(4-hydroxyphenyl)propanoic acid;urea (PubChem CID 18402054) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;urea.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;urea |
|---|---|
| PubChem CID | 18402054 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;urea |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)O.NC(N)=O |
| InChI | InChI=1S/C9H11NO3.CH4N2O/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;2-1(3)4/h1-4,8,11H,5,10H2,(H,12,13);(H4,2,3,4) |
| InChIKey | WPUICLBXMUNOGW-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |