C9H13NO4 — CID 66692874
2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate (PubChem CID 66692874) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate |
|---|---|
| PubChem CID | 66692874 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrate |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)O.O |
| InChI | InChI=1S/C9H11NO3.H2O/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;/h1-4,8,11H,5,10H2,(H,12,13);1H2 |
| InChIKey | QVKZWRGZMUGTLO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |