C9H13NO3S — CID 161476497
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfane (PubChem CID 161476497) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfane.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfane |
|---|---|
| PubChem CID | 161476497 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfane |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O.S |
| InChI | InChI=1S/C9H11NO3.H2S/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;/h1-4,8,11H,5,10H2,(H,12,13);1H2/t8-;/m0./s1 |
| InChIKey | WDTZIAFJEBGASY-QRPNPIFTSA-N |
| XLogP | 0.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |