C9H14N2O3 — CID 87217970
(2R)-2-amino-3-(4-hydroxyphenyl)propanoic acid;azane (PubChem CID 87217970) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-hydroxyphenyl)propanoic acid;azane.
| Compound Name | (2R)-2-amino-3-(4-hydroxyphenyl)propanoic acid;azane |
|---|---|
| PubChem CID | 87217970 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (2R)-2-amino-3-(4-hydroxyphenyl)propanoic acid;azane |
| SMILES | N.N[C@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.H3N/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;/h1-4,8,11H,5,10H2,(H,12,13);1H3/t8-;/m1./s1 |
| InChIKey | IHEHMBYPHSNAJH-DDWIOCJRSA-N |
| XLogP | 0.51 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |