C9H11NNa2O3 — CID 66602062
L-Tyrosine (disodium) (PubChem CID 66602062) has the molecular formula C9H11NNa2O3 and a molecular weight of 227.17 g/mol.
| Compound Name | L-Tyrosine (disodium) |
|---|---|
| PubChem CID | 66602062 |
| Molecular Formula | C9H11NNa2O3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | — |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O.[Na].[Na] |
| InChI | InChI=1S/C9H11NO3.2Na/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;;/h1-4,8,11H,5,10H2,(H,12,13);;/t8-;;/m0../s1 |
| InChIKey | NKQKDBKPUPDYCQ-JZGIKJSDSA-N |
| XLogP | -0.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |