C9H15N3O3 — CID 22117080
2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrazine (PubChem CID 22117080) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrazine.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrazine |
|---|---|
| PubChem CID | 22117080 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;hydrazine |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)O.NN |
| InChI | InChI=1S/C9H11NO3.H4N2/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-2/h1-4,8,11H,5,10H2,(H,12,13);1-2H2 |
| InChIKey | AUSVDHIOTZXIFU-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|